C27H25N3O5 — CID 15816256
3,4,5-trimethoxy-N-[(11R)-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]benzamide (PubChem CID 15816256) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(11R)-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(11R)-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]benzamide |
|---|---|
| PubChem CID | 15816256 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(11R)-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]benzamide |
| SMILES | COc1cc(C(=O)N[C@@H]2N=C(c3ccccc3)c3cccc4c3N(CC4)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C27H25N3O5/c1-33-20-14-18(15-21(34-2)24(20)35-3)26(31)29-25-27(32)30-13-12-17-10-7-11-19(23(17)30)22(28-25)16-8-5-4-6-9-16/h4-11,14-15,25H,12-13H2,1-3H3,(H,29,31)/t25-/m0/s1 |
| InChIKey | CLUPWGYEJQAUQZ-VWLOTQADSA-N |
| XLogP | 3.21 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |