C42H41N5O6 — CID 172959717
[(E)-1-(3-cyclopentyloxy-4-methoxyphenyl)ethylideneamino] acetate;N-[(11R)-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]-1H-indole-2-carboxamide (PubChem CID 172959717) has the molecular formula C42H41N5O6 and a molecular weight of 711.82 g/mol. Its IUPAC name is [(E)-1-(3-cyclopentyloxy-4-methoxyphenyl)ethylideneamino] acetate;N-[(11R)-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]-1H-indole-2-carboxamide.
| Compound Name | [(E)-1-(3-cyclopentyloxy-4-methoxyphenyl)ethylideneamino] acetate;N-[(11R)-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 172959717 |
| Molecular Formula | C42H41N5O6 |
| Molecular Weight | 711.82 g/mol |
| Exact Mass | 711.31 |
| IUPAC Name | [(E)-1-(3-cyclopentyloxy-4-methoxyphenyl)ethylideneamino] acetate;N-[(11R)-12-oxo-9-phenyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4(13),5,7,9-tetraen-11-yl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc(/C(C)=N/OC(C)=O)cc1OC1CCCC1.O=C(N[C@@H]1N=C(c2ccccc2)c2cccc3c2N(CC3)C1=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H20N4O2.C16H21NO4/c31-25(21-15-18-9-4-5-12-20(18)27-21)29-24-26(32)30-14-13-17-10-6-11-19(23(17)30)22(28-24)16-7-2-1-3-8-16;1-11(17-21-12(2)18)13-8-9-15(19-3)16(10-13)20-14-6-4-5-7-14/h1-12,15,24,27H,13-14H2,(H,29,31);8-10,14H,4-7H2,1-3H3/b;17-11+/t24-;/m0./s1 |
| InChIKey | GTIZZKBBSSAOQP-ODTWDJOXSA-N |
| XLogP | 6.97 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.82 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|