C12H23N3OS — CID 102953567
2-methyl-N-(2-thiomorpholin-4-ylethyl)pyrrolidine-3-carboxamide (PubChem CID 102953567) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-methyl-N-(2-thiomorpholin-4-ylethyl)pyrrolidine-3-carboxamide.
| Compound Name | 2-methyl-N-(2-thiomorpholin-4-ylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 102953567 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-methyl-N-(2-thiomorpholin-4-ylethyl)pyrrolidine-3-carboxamide |
| SMILES | CC1NCCC1C(=O)NCCN1CCSCC1 |
| InChI | InChI=1S/C12H23N3OS/c1-10-11(2-3-13-10)12(16)14-4-5-15-6-8-17-9-7-15/h10-11,13H,2-9H2,1H3,(H,14,16) |
| InChIKey | CTBOBKHDYCRPRQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |