C13H14BrNOS2 — CID 102962098
(3-bromo-4-methylpiperidin-1-yl)-thieno[3,2-b]thiophen-5-ylmethanone (PubChem CID 102962098) has the molecular formula C13H14BrNOS2 and a molecular weight of 344.30 g/mol. Its IUPAC name is (3-bromo-4-methylpiperidin-1-yl)-thieno[3,2-b]thiophen-5-ylmethanone.
| Compound Name | (3-bromo-4-methylpiperidin-1-yl)-thieno[3,2-b]thiophen-5-ylmethanone |
|---|---|
| PubChem CID | 102962098 |
| Molecular Formula | C13H14BrNOS2 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | (3-bromo-4-methylpiperidin-1-yl)-thieno[3,2-b]thiophen-5-ylmethanone |
| SMILES | CC1CCN(C(=O)c2cc3sccc3s2)CC1Br |
| InChI | InChI=1S/C13H14BrNOS2/c1-8-2-4-15(7-9(8)14)13(16)12-6-11-10(18-12)3-5-17-11/h3,5-6,8-9H,2,4,7H2,1H3 |
| InChIKey | NHVVHTNYHUUIEG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|