C20H18N2O5S2 — CID 10296333
5-(3-acetamidophenyl)-3-[(2-methylphenyl)sulfonylamino]thiophene-2-carboxylic acid (PubChem CID 10296333) has the molecular formula C20H18N2O5S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-(3-acetamidophenyl)-3-[(2-methylphenyl)sulfonylamino]thiophene-2-carboxylic acid.
| Compound Name | 5-(3-acetamidophenyl)-3-[(2-methylphenyl)sulfonylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 10296333 |
| Molecular Formula | C20H18N2O5S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 5-(3-acetamidophenyl)-3-[(2-methylphenyl)sulfonylamino]thiophene-2-carboxylic acid |
| SMILES | CC(=O)Nc1cccc(-c2cc(NS(=O)(=O)c3ccccc3C)c(C(=O)O)s2)c1 |
| InChI | InChI=1S/C20H18N2O5S2/c1-12-6-3-4-9-18(12)29(26,27)22-16-11-17(28-19(16)20(24)25)14-7-5-8-15(10-14)21-13(2)23/h3-11,22H,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | APDZFMJREYOVST-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |