C19H17NO6S2 — CID 68799415
[5-(4-methoxyphenyl)-3-[(2-methylphenyl)sulfonylamino]thiophen-2-yl] hydrogen carbonate (PubChem CID 68799415) has the molecular formula C19H17NO6S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)-3-[(2-methylphenyl)sulfonylamino]thiophen-2-yl] hydrogen carbonate.
| Compound Name | [5-(4-methoxyphenyl)-3-[(2-methylphenyl)sulfonylamino]thiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68799415 |
| Molecular Formula | C19H17NO6S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | [5-(4-methoxyphenyl)-3-[(2-methylphenyl)sulfonylamino]thiophen-2-yl] hydrogen carbonate |
| SMILES | COc1ccc(-c2cc(NS(=O)(=O)c3ccccc3C)c(OC(=O)O)s2)cc1 |
| InChI | InChI=1S/C19H17NO6S2/c1-12-5-3-4-6-17(12)28(23,24)20-15-11-16(27-18(15)26-19(21)22)13-7-9-14(25-2)10-8-13/h3-11,20H,1-2H3,(H,21,22) |
| InChIKey | BBYKLHWVHFNYMV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |