C17H14N2O5S2 — CID 68797081
[3-[(2-methylphenyl)sulfonylamino]-5-pyridin-2-ylthiophen-2-yl] hydrogen carbonate (PubChem CID 68797081) has the molecular formula C17H14N2O5S2 and a molecular weight of 390.44 g/mol. Its IUPAC name is [3-[(2-methylphenyl)sulfonylamino]-5-pyridin-2-ylthiophen-2-yl] hydrogen carbonate.
| Compound Name | [3-[(2-methylphenyl)sulfonylamino]-5-pyridin-2-ylthiophen-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68797081 |
| Molecular Formula | C17H14N2O5S2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | [3-[(2-methylphenyl)sulfonylamino]-5-pyridin-2-ylthiophen-2-yl] hydrogen carbonate |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1cc(-c2ccccn2)sc1OC(=O)O |
| InChI | InChI=1S/C17H14N2O5S2/c1-11-6-2-3-8-15(11)26(22,23)19-13-10-14(12-7-4-5-9-18-12)25-16(13)24-17(20)21/h2-10,19H,1H3,(H,20,21) |
| InChIKey | WXERHULVQUNRHW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |