C22H23NO3S2 — CID 2809020
N-[2-acetyl-5-(4-tert-butylphenyl)thiophen-3-yl]benzenesulfonamide (PubChem CID 2809020) has the molecular formula C22H23NO3S2 and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[2-acetyl-5-(4-tert-butylphenyl)thiophen-3-yl]benzenesulfonamide.
| Compound Name | N-[2-acetyl-5-(4-tert-butylphenyl)thiophen-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2809020 |
| Molecular Formula | C22H23NO3S2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-[2-acetyl-5-(4-tert-butylphenyl)thiophen-3-yl]benzenesulfonamide |
| SMILES | CC(=O)c1sc(-c2ccc(C(C)(C)C)cc2)cc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO3S2/c1-15(24)21-19(23-28(25,26)18-8-6-5-7-9-18)14-20(27-21)16-10-12-17(13-11-16)22(2,3)4/h5-14,23H,1-4H3 |
| InChIKey | KGOVHTHIBLAJMO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |