C10H12N2O3 — CID 102973559
4-(cyclopropylmethoxymethyl)pyrimidine-5-carboxylic acid (PubChem CID 102973559) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-(cyclopropylmethoxymethyl)pyrimidine-5-carboxylic acid.
| Compound Name | 4-(cyclopropylmethoxymethyl)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 102973559 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-(cyclopropylmethoxymethyl)pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cncnc1COCC1CC1 |
| InChI | InChI=1S/C10H12N2O3/c13-10(14)8-3-11-6-12-9(8)5-15-4-7-1-2-7/h3,6-7H,1-2,4-5H2,(H,13,14) |
| InChIKey | NZORZULCAJINAL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |