C14H22N2O3 — CID 102978865
N-[3-(dimethylamino)propyl]-N-ethyl-3,4-dihydroxybenzamide (PubChem CID 102978865) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-ethyl-3,4-dihydroxybenzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-ethyl-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 102978865 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-ethyl-3,4-dihydroxybenzamide |
| SMILES | CCN(CCCN(C)C)C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-4-16(9-5-8-15(2)3)14(19)11-6-7-12(17)13(18)10-11/h6-7,10,17-18H,4-5,8-9H2,1-3H3 |
| InChIKey | WGUVLEIGFXMDAN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|