C11H10BrClN2O — CID 102979133
N-(5-bromo-2-chloro-3-pyridinyl)hexa-2,4-dienamide (PubChem CID 102979133) has the molecular formula C11H10BrClN2O and a molecular weight of 301.57 g/mol. Its IUPAC name is N-(5-bromo-2-chloro-3-pyridinyl)hexa-2,4-dienamide.
| Compound Name | N-(5-bromo-2-chloro-3-pyridinyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 102979133 |
| Molecular Formula | C11H10BrClN2O |
| Molecular Weight | 301.57 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | N-(5-bromo-2-chloro-3-pyridinyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)Nc1cc(Br)cnc1Cl |
| InChI | InChI=1S/C11H10BrClN2O/c1-2-3-4-5-10(16)15-9-6-8(12)7-14-11(9)13/h2-7H,1H3,(H,15,16) |
| InChIKey | XZMSEYQVFUJYGK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|