C22H15N5O7 — CID 10298296
2-[2-(1,3-dioxoisoindol-2-yl)oxy-3-(2-nitroimidazol-1-yl)propyl]isoindole-1,3-dione (PubChem CID 10298296) has the molecular formula C22H15N5O7 and a molecular weight of 461.39 g/mol. Its IUPAC name is 2-[2-(1,3-dioxoisoindol-2-yl)oxy-3-(2-nitroimidazol-1-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(1,3-dioxoisoindol-2-yl)oxy-3-(2-nitroimidazol-1-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10298296 |
| Molecular Formula | C22H15N5O7 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 2-[2-(1,3-dioxoisoindol-2-yl)oxy-3-(2-nitroimidazol-1-yl)propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC(Cn1ccnc1[N+](=O)[O-])ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H15N5O7/c28-18-14-5-1-2-6-15(14)19(29)25(18)12-13(11-24-10-9-23-22(24)27(32)33)34-26-20(30)16-7-3-4-8-17(16)21(26)31/h1-10,13H,11-12H2 |
| InChIKey | VRPQUBSVCZNCCM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 144.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|