C13H16N4O3 — CID 102986412
6-[(3R)-3-aminopiperidin-1-yl]-5-nitro-1,3-dihydroindol-2-one (PubChem CID 102986412) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 6-[(3R)-3-aminopiperidin-1-yl]-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 6-[(3R)-3-aminopiperidin-1-yl]-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 102986412 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 6-[(3R)-3-aminopiperidin-1-yl]-5-nitro-1,3-dihydroindol-2-one |
| SMILES | N[C@@H]1CCCN(c2cc3c(cc2[N+](=O)[O-])CC(=O)N3)C1 |
| InChI | InChI=1S/C13H16N4O3/c14-9-2-1-3-16(7-9)11-6-10-8(5-13(18)15-10)4-12(11)17(19)20/h4,6,9H,1-3,5,7,14H2,(H,15,18)/t9-/m1/s1 |
| InChIKey | KYBJDIYQQBYBEV-SECBINFHSA-N |
| XLogP | 1.02 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|