C14H18N4O3 — CID 65462407
6-(2,2-dimethylpiperazin-1-yl)-5-nitro-1,3-dihydroindol-2-one (PubChem CID 65462407) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 6-(2,2-dimethylpiperazin-1-yl)-5-nitro-1,3-dihydroindol-2-one.
| Compound Name | 6-(2,2-dimethylpiperazin-1-yl)-5-nitro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 65462407 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 6-(2,2-dimethylpiperazin-1-yl)-5-nitro-1,3-dihydroindol-2-one |
| SMILES | CC1(C)CNCCN1c1cc2c(cc1[N+](=O)[O-])CC(=O)N2 |
| InChI | InChI=1S/C14H18N4O3/c1-14(2)8-15-3-4-17(14)11-7-10-9(6-13(19)16-10)5-12(11)18(20)21/h5,7,15H,3-4,6,8H2,1-2H3,(H,16,19) |
| InChIKey | MBWDXMKQJUJHFO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|