C30H36N4O — CID 10298788
3-[2-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]phenoxy]-N,N-dimethylaniline (PubChem CID 10298788) has the molecular formula C30H36N4O and a molecular weight of 468.65 g/mol. Its IUPAC name is 3-[2-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]phenoxy]-N,N-dimethylaniline.
| Compound Name | 3-[2-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]phenoxy]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 10298788 |
| Molecular Formula | C30H36N4O |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 3-[2-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]phenoxy]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(Oc2ccccc2N2CCN(CCCCc3c[nH]c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C30H36N4O/c1-32(2)25-11-9-12-26(22-25)35-30-16-6-5-15-29(30)34-20-18-33(19-21-34)17-8-7-10-24-23-31-28-14-4-3-13-27(24)28/h3-6,9,11-16,22-23,31H,7-8,10,17-21H2,1-2H3 |
| InChIKey | BCRYPVTXFYJJFK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 34.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|