C31H42N4O2 — CID 71813992
N-cyclohexyl-2-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 71813992) has the molecular formula C31H42N4O2 and a molecular weight of 502.70 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | N-cyclohexyl-2-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 71813992 |
| Molecular Formula | C31H42N4O2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | N-cyclohexyl-2-[4-[4-(1H-indol-3-yl)butyl]piperazin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1N(C(=O)CN1CCN(CCCCc2c[nH]c3ccccc23)CC1)C1CCCCC1 |
| InChI | InChI=1S/C31H42N4O2/c1-37-30-17-8-7-16-29(30)35(26-12-3-2-4-13-26)31(36)24-34-21-19-33(20-22-34)18-10-9-11-25-23-32-28-15-6-5-14-27(25)28/h5-8,14-17,23,26,32H,2-4,9-13,18-22,24H2,1H3 |
| InChIKey | VLSUYDUNLLYIPY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|