C26H23N5O4 — CID 10298819
N-[3-[4-[(2-naphthalen-1-ylacetyl)amino]-1H-pyrazol-5-yl]cyclobutyl]-3-nitrobenzamide (PubChem CID 10298819) has the molecular formula C26H23N5O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is N-[3-[4-[(2-naphthalen-1-ylacetyl)amino]-1H-pyrazol-5-yl]cyclobutyl]-3-nitrobenzamide.
| Compound Name | N-[3-[4-[(2-naphthalen-1-ylacetyl)amino]-1H-pyrazol-5-yl]cyclobutyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 10298819 |
| Molecular Formula | C26H23N5O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[3-[4-[(2-naphthalen-1-ylacetyl)amino]-1H-pyrazol-5-yl]cyclobutyl]-3-nitrobenzamide |
| SMILES | O=C(Cc1cccc2ccccc12)Nc1cn[nH]c1C1CC(NC(=O)c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C26H23N5O4/c32-24(14-17-7-3-6-16-5-1-2-10-22(16)17)29-23-15-27-30-25(23)19-11-20(12-19)28-26(33)18-8-4-9-21(13-18)31(34)35/h1-10,13,15,19-20H,11-12,14H2,(H,27,30)(H,28,33)(H,29,32) |
| InChIKey | PAWYWSIIYRFZQT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|