C29H36N2O4 — CID 10299269
ethyl 5-[5-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-2H-quinolin-1-yl]pentanoate (PubChem CID 10299269) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is ethyl 5-[5-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-2H-quinolin-1-yl]pentanoate.
| Compound Name | ethyl 5-[5-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-2H-quinolin-1-yl]pentanoate |
|---|---|
| PubChem CID | 10299269 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | ethyl 5-[5-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-2H-quinolin-1-yl]pentanoate |
| SMILES | CCOC(=O)CCCCN1CCCc2c(OCCc3nc(-c4ccc(C)cc4)oc3C)cccc21 |
| InChI | InChI=1S/C29H36N2O4/c1-4-33-28(32)12-5-6-18-31-19-8-9-24-26(31)10-7-11-27(24)34-20-17-25-22(3)35-29(30-25)23-15-13-21(2)14-16-23/h7,10-11,13-16H,4-6,8-9,12,17-20H2,1-3H3 |
| InChIKey | IRCMMXWCEUZTQR-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|