C11H24N4O2 — CID 102992798
2-amino-N-[3-(dimethylamino)propyl]-N-ethylbutanediamide (PubChem CID 102992798) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-amino-N-[3-(dimethylamino)propyl]-N-ethylbutanediamide.
| Compound Name | 2-amino-N-[3-(dimethylamino)propyl]-N-ethylbutanediamide |
|---|---|
| PubChem CID | 102992798 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-amino-N-[3-(dimethylamino)propyl]-N-ethylbutanediamide |
| SMILES | CCN(CCCN(C)C)C(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C11H24N4O2/c1-4-15(7-5-6-14(2)3)11(17)9(12)8-10(13)16/h9H,4-8,12H2,1-3H3,(H2,13,16) |
| InChIKey | NWSVKHXJLCDZJX-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |