C14H30N4O3 — CID 64896902
3-amino-4-[bis[3-(dimethylamino)propyl]amino]-4-oxobutanoic acid (PubChem CID 64896902) has the molecular formula C14H30N4O3 and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-amino-4-[bis[3-(dimethylamino)propyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[bis[3-(dimethylamino)propyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64896902 |
| Molecular Formula | C14H30N4O3 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | 3-amino-4-[bis[3-(dimethylamino)propyl]amino]-4-oxobutanoic acid |
| SMILES | CN(C)CCCN(CCCN(C)C)C(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C14H30N4O3/c1-16(2)7-5-9-18(10-6-8-17(3)4)14(21)12(15)11-13(19)20/h12H,5-11,15H2,1-4H3,(H,19,20) |
| InChIKey | JMFKLZKLXMLPHN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |