C12H26N4O3 — CID 54874249
2-amino-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)butanediamide (PubChem CID 54874249) has the molecular formula C12H26N4O3 and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-amino-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)butanediamide.
| Compound Name | 2-amino-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)butanediamide |
|---|---|
| PubChem CID | 54874249 |
| Molecular Formula | C12H26N4O3 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-amino-N-[3-(dimethylamino)propyl]-N-(2-methoxyethyl)butanediamide |
| SMILES | COCCN(CCCN(C)C)C(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C12H26N4O3/c1-15(2)5-4-6-16(7-8-19-3)12(18)10(13)9-11(14)17/h10H,4-9,13H2,1-3H3,(H2,14,17) |
| InChIKey | QTVPVQVWWRBLII-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |