C28H39N5O3 — CID 10300247
methyl 3-[[2-[2-(3-methylphenyl)ethylamino]ethyl-[2-(piperazin-1-ylmethyl)prop-2-enyl]carbamoyl]amino]benzoate (PubChem CID 10300247) has the molecular formula C28H39N5O3 and a molecular weight of 493.65 g/mol. Its IUPAC name is methyl 3-[[2-[2-(3-methylphenyl)ethylamino]ethyl-[2-(piperazin-1-ylmethyl)prop-2-enyl]carbamoyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[2-(3-methylphenyl)ethylamino]ethyl-[2-(piperazin-1-ylmethyl)prop-2-enyl]carbamoyl]amino]benzoate |
|---|---|
| PubChem CID | 10300247 |
| Molecular Formula | C28H39N5O3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.31 |
| IUPAC Name | methyl 3-[[2-[2-(3-methylphenyl)ethylamino]ethyl-[2-(piperazin-1-ylmethyl)prop-2-enyl]carbamoyl]amino]benzoate |
| SMILES | C=C(CN1CCNCC1)CN(CCNCCc1cccc(C)c1)C(=O)Nc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C28H39N5O3/c1-22-6-4-7-24(18-22)10-11-29-14-17-33(21-23(2)20-32-15-12-30-13-16-32)28(35)31-26-9-5-8-25(19-26)27(34)36-3/h4-9,18-19,29-30H,2,10-17,20-21H2,1,3H3,(H,31,35) |
| InChIKey | ARQUWZYVOXFRCE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|