C7H13N5O — CID 103011559
1-hydroxy-2-[2-(2-methylpyrazol-3-yl)ethyl]guanidine (PubChem CID 103011559) has the molecular formula C7H13N5O and a molecular weight of 183.22 g/mol. Its IUPAC name is 1-hydroxy-2-[2-(2-methylpyrazol-3-yl)ethyl]guanidine.
| Compound Name | 1-hydroxy-2-[2-(2-methylpyrazol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 103011559 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 1-hydroxy-2-[2-(2-methylpyrazol-3-yl)ethyl]guanidine |
| SMILES | Cn1nccc1CC/N=C(\N)NO |
| InChI | InChI=1S/C7H13N5O/c1-12-6(3-5-10-12)2-4-9-7(8)11-13/h3,5,13H,2,4H2,1H3,(H3,8,9,11) |
| InChIKey | NPWPNTPXMRCUNA-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|