C11H15ClN4O2S — CID 103013272
2-ethyl-1-[2-(2-methylpyrazol-3-yl)ethyl]imidazole-4-sulfonyl chloride (PubChem CID 103013272) has the molecular formula C11H15ClN4O2S and a molecular weight of 302.79 g/mol. Its IUPAC name is 2-ethyl-1-[2-(2-methylpyrazol-3-yl)ethyl]imidazole-4-sulfonyl chloride.
| Compound Name | 2-ethyl-1-[2-(2-methylpyrazol-3-yl)ethyl]imidazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 103013272 |
| Molecular Formula | C11H15ClN4O2S |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-ethyl-1-[2-(2-methylpyrazol-3-yl)ethyl]imidazole-4-sulfonyl chloride |
| SMILES | CCc1nc(S(=O)(=O)Cl)cn1CCc1ccnn1C |
| InChI | InChI=1S/C11H15ClN4O2S/c1-3-10-14-11(19(12,17)18)8-16(10)7-5-9-4-6-13-15(9)2/h4,6,8H,3,5,7H2,1-2H3 |
| InChIKey | DYZBEEKQQCCHKB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |