C10H17ClN2O4S2 — CID 106728499
2-ethyl-1-(2-propan-2-ylsulfonylethyl)imidazole-4-sulfonyl chloride (PubChem CID 106728499) has the molecular formula C10H17ClN2O4S2 and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-ethyl-1-(2-propan-2-ylsulfonylethyl)imidazole-4-sulfonyl chloride.
| Compound Name | 2-ethyl-1-(2-propan-2-ylsulfonylethyl)imidazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 106728499 |
| Molecular Formula | C10H17ClN2O4S2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-ethyl-1-(2-propan-2-ylsulfonylethyl)imidazole-4-sulfonyl chloride |
| SMILES | CCc1nc(S(=O)(=O)Cl)cn1CCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C10H17ClN2O4S2/c1-4-9-12-10(19(11,16)17)7-13(9)5-6-18(14,15)8(2)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | NLRWLVLJUVATMR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |