C32H26O3S2 — CID 10301725
3-[4-[3,3-bis(4-thiophen-2-ylphenyl)prop-2-enoxy]phenyl]propanoic acid (PubChem CID 10301725) has the molecular formula C32H26O3S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 3-[4-[3,3-bis(4-thiophen-2-ylphenyl)prop-2-enoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[3,3-bis(4-thiophen-2-ylphenyl)prop-2-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10301725 |
| Molecular Formula | C32H26O3S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 3-[4-[3,3-bis(4-thiophen-2-ylphenyl)prop-2-enoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCC=C(c2ccc(-c3cccs3)cc2)c2ccc(-c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C32H26O3S2/c33-32(34)18-7-23-5-16-28(17-6-23)35-20-19-29(24-8-12-26(13-9-24)30-3-1-21-36-30)25-10-14-27(15-11-25)31-4-2-22-37-31/h1-6,8-17,19,21-22H,7,18,20H2,(H,33,34) |
| InChIKey | ZPSDZTQADYYEOP-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |