C22H40N10O6 — CID 10302403
(2S)-1-[(2S)-2-[[(2S)-2-acetamido-5-(carbamoylamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-[(2R)-1-amino-1-oxopropan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 10302403) has the molecular formula C22H40N10O6 and a molecular weight of 540.63 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2S)-2-acetamido-5-(carbamoylamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-[(2R)-1-amino-1-oxopropan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[[(2S)-2-acetamido-5-(carbamoylamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-[(2R)-1-amino-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10302403 |
| Molecular Formula | C22H40N10O6 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S)-2-acetamido-5-(carbamoylamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-N-[(2R)-1-amino-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N[C@@H](CCCNC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)N[C@H](C)C(N)=O |
| InChI | InChI=1S/C22H40N10O6/c1-12(17(23)34)29-19(36)16-8-5-11-32(16)20(37)15(7-4-9-27-21(24)25)31-18(35)14(30-13(2)33)6-3-10-28-22(26)38/h12,14-16H,3-11H2,1-2H3,(H2,23,34)(H,29,36)(H,30,33)(H,31,35)(H4,24,25,27)(H3,26,28,38)/t12-,14+,15+,16+/m1/s1 |
| InChIKey | VUFSHQTVRCXZHP-OEAJRASXSA-N |
| XLogP | -3.54 |
| TPSA | 270.22 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|