C25H30N4O8S — CID 10302614
N-[(2S)-4-methyl-1-[[1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 10302614) has the molecular formula C25H30N4O8S and a molecular weight of 546.60 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-[[1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(2S)-4-methyl-1-[[1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 10302614 |
| Molecular Formula | C25H30N4O8S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | N-[(2S)-4-methyl-1-[[1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc2c(c1)OCO2)C(=O)NC1CCCN(S(=O)(=O)c2cccc[n+]2[O-])CC1=O |
| InChI | InChI=1S/C25H30N4O8S/c1-16(2)12-19(27-24(31)17-8-9-21-22(13-17)37-15-36-21)25(32)26-18-6-5-10-28(14-20(18)30)38(34,35)23-7-3-4-11-29(23)33/h3-4,7-9,11,13,16,18-19H,5-6,10,12,14-15H2,1-2H3,(H,26,32)(H,27,31)/t18?,19-/m0/s1 |
| InChIKey | YSMQVHTZFXFKAI-GGYWPGCISA-N |
| XLogP | 0.73 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|