C27H32N4O7S — CID 59045790
3-methyl-N-[(2R)-4-methyl-1-[[(4R)-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 59045790) has the molecular formula C27H32N4O7S and a molecular weight of 556.64 g/mol. Its IUPAC name is 3-methyl-N-[(2R)-4-methyl-1-[[(4R)-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-methyl-N-[(2R)-4-methyl-1-[[(4R)-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 59045790 |
| Molecular Formula | C27H32N4O7S |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 3-methyl-N-[(2R)-4-methyl-1-[[(4R)-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N[C@H](CC(C)C)C(=O)N[C@@H]2CCCN(S(=O)(=O)c3cccc[n+]3[O-])CC2=O)oc2ccccc12 |
| InChI | InChI=1S/C27H32N4O7S/c1-17(2)15-21(29-27(34)25-18(3)19-9-4-5-11-23(19)38-25)26(33)28-20-10-8-13-30(16-22(20)32)39(36,37)24-12-6-7-14-31(24)35/h4-7,9,11-12,14,17,20-21H,8,10,13,15-16H2,1-3H3,(H,28,33)(H,29,34)/t20-,21-/m1/s1 |
| InChIKey | HLJNTSNPNXSMNC-NHCUHLMSSA-N |
| XLogP | 2.06 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|