C27H31FN4O7S — CID 59045854
6-fluoro-3-methyl-N-[4-methyl-1-[[(4S)-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide (PubChem CID 59045854) has the molecular formula C27H31FN4O7S and a molecular weight of 574.63 g/mol. Its IUPAC name is 6-fluoro-3-methyl-N-[4-methyl-1-[[(4S)-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide.
| Compound Name | 6-fluoro-3-methyl-N-[4-methyl-1-[[(4S)-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 59045854 |
| Molecular Formula | C27H31FN4O7S |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 6-fluoro-3-methyl-N-[4-methyl-1-[[(4S)-1-(1-oxidopyridin-1-ium-2-yl)sulfonyl-3-oxoazepan-4-yl]amino]-1-oxopentan-2-yl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(CC(C)C)C(=O)N[C@H]2CCCN(S(=O)(=O)c3cccc[n+]3[O-])CC2=O)oc2cc(F)ccc12 |
| InChI | InChI=1S/C27H31FN4O7S/c1-16(2)13-21(30-27(35)25-17(3)19-10-9-18(28)14-23(19)39-25)26(34)29-20-7-6-11-31(15-22(20)33)40(37,38)24-8-4-5-12-32(24)36/h4-5,8-10,12,14,16,20-21H,6-7,11,13,15H2,1-3H3,(H,29,34)(H,30,35)/t20-,21?/m0/s1 |
| InChIKey | PZTKVVLABXQGHE-BGERDNNASA-N |
| XLogP | 2.20 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|