C31H32F2N4O3 — CID 10302615
1-[3-[1-[(3,4-difluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propyl]-3-quinolin-4-ylurea (PubChem CID 10302615) has the molecular formula C31H32F2N4O3 and a molecular weight of 546.62 g/mol. Its IUPAC name is 1-[3-[1-[(3,4-difluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propyl]-3-quinolin-4-ylurea.
| Compound Name | 1-[3-[1-[(3,4-difluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propyl]-3-quinolin-4-ylurea |
|---|---|
| PubChem CID | 10302615 |
| Molecular Formula | C31H32F2N4O3 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 1-[3-[1-[(3,4-difluorophenyl)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propyl]-3-quinolin-4-ylurea |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(F)c(F)c1)N(CCCNC(=O)Nc1ccnc3ccccc13)CC2 |
| InChI | InChI=1S/C31H32F2N4O3/c1-39-29-18-21-11-15-37(28(23(21)19-30(29)40-2)17-20-8-9-24(32)25(33)16-20)14-5-12-35-31(38)36-27-10-13-34-26-7-4-3-6-22(26)27/h3-4,6-10,13,16,18-19,28H,5,11-12,14-15,17H2,1-2H3,(H2,34,35,36,38) |
| InChIKey | UTGYUSGELCNAIM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|