C13H20F2N2O — CID 103027886
1-(4,4-difluorocyclohexyl)-3-(1-methylpyrazol-4-yl)propan-1-ol (PubChem CID 103027886) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-3-(1-methylpyrazol-4-yl)propan-1-ol.
| Compound Name | 1-(4,4-difluorocyclohexyl)-3-(1-methylpyrazol-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 103027886 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-3-(1-methylpyrazol-4-yl)propan-1-ol |
| SMILES | Cn1cc(CCC(O)C2CCC(F)(F)CC2)cn1 |
| InChI | InChI=1S/C13H20F2N2O/c1-17-9-10(8-16-17)2-3-12(18)11-4-6-13(14,15)7-5-11/h8-9,11-12,18H,2-7H2,1H3 |
| InChIKey | OELYSVHZIMXTTI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |