C29H33F2N7O3 — CID 10303289
4-butyl-N-[1-(3,5-difluorophenyl)-3-hydroxy-5-(1H-1,2,4-triazol-5-yl)pentan-2-yl]-8-(1,3-oxazol-2-yl)-2,3-dihydro-1H-quinoxaline-6-carboxamide (PubChem CID 10303289) has the molecular formula C29H33F2N7O3 and a molecular weight of 565.63 g/mol. Its IUPAC name is 4-butyl-N-[1-(3,5-difluorophenyl)-3-hydroxy-5-(1H-1,2,4-triazol-5-yl)pentan-2-yl]-8-(1,3-oxazol-2-yl)-2,3-dihydro-1H-quinoxaline-6-carboxamide.
| Compound Name | 4-butyl-N-[1-(3,5-difluorophenyl)-3-hydroxy-5-(1H-1,2,4-triazol-5-yl)pentan-2-yl]-8-(1,3-oxazol-2-yl)-2,3-dihydro-1H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 10303289 |
| Molecular Formula | C29H33F2N7O3 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 4-butyl-N-[1-(3,5-difluorophenyl)-3-hydroxy-5-(1H-1,2,4-triazol-5-yl)pentan-2-yl]-8-(1,3-oxazol-2-yl)-2,3-dihydro-1H-quinoxaline-6-carboxamide |
| SMILES | CCCCN1CCNc2c(-c3ncco3)cc(C(=O)NC(Cc3cc(F)cc(F)c3)C(O)CCc3ncn[nH]3)cc21 |
| InChI | InChI=1S/C29H33F2N7O3/c1-2-3-8-38-9-6-32-27-22(29-33-7-10-41-29)14-19(15-24(27)38)28(40)36-23(13-18-11-20(30)16-21(31)12-18)25(39)4-5-26-34-17-35-37-26/h7,10-12,14-17,23,25,32,39H,2-6,8-9,13H2,1H3,(H,36,40)(H,34,35,37) |
| InChIKey | UAPGLYMPODYHHV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |