C15H22O5S — CID 103034372
3-[4-(3-methoxy-3-methylbutyl)sulfonylphenyl]propanoic acid (PubChem CID 103034372) has the molecular formula C15H22O5S and a molecular weight of 314.40 g/mol. Its IUPAC name is 3-[4-(3-methoxy-3-methylbutyl)sulfonylphenyl]propanoic acid.
| Compound Name | 3-[4-(3-methoxy-3-methylbutyl)sulfonylphenyl]propanoic acid |
|---|---|
| PubChem CID | 103034372 |
| Molecular Formula | C15H22O5S |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-[4-(3-methoxy-3-methylbutyl)sulfonylphenyl]propanoic acid |
| SMILES | COC(C)(C)CCS(=O)(=O)c1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C15H22O5S/c1-15(2,20-3)10-11-21(18,19)13-7-4-12(5-8-13)6-9-14(16)17/h4-5,7-8H,6,9-11H2,1-3H3,(H,16,17) |
| InChIKey | QRBYLGOGLBXPCC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |