C10H20O4S — CID 103035083
3-(3-methoxy-3-methylbutyl)-1,1-dioxothiolan-3-ol (PubChem CID 103035083) has the molecular formula C10H20O4S and a molecular weight of 236.33 g/mol. Its IUPAC name is 3-(3-methoxy-3-methylbutyl)-1,1-dioxothiolan-3-ol.
| Compound Name | 3-(3-methoxy-3-methylbutyl)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 103035083 |
| Molecular Formula | C10H20O4S |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3-(3-methoxy-3-methylbutyl)-1,1-dioxothiolan-3-ol |
| SMILES | COC(C)(C)CCC1(O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H20O4S/c1-9(2,14-3)4-5-10(11)6-7-15(12,13)8-10/h11H,4-8H2,1-3H3 |
| InChIKey | GEQIJPDGKXUVFE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |