C30H20N2O6S — CID 10303511
2-(4-dibenzofuran-4-yl-2-methoxyphenyl)-9-hydroxy-3H-benzo[e]benzimidazole-7-sulfonic acid (PubChem CID 10303511) has the molecular formula C30H20N2O6S and a molecular weight of 536.57 g/mol. Its IUPAC name is 2-(4-dibenzofuran-4-yl-2-methoxyphenyl)-9-hydroxy-3H-benzo[e]benzimidazole-7-sulfonic acid.
| Compound Name | 2-(4-dibenzofuran-4-yl-2-methoxyphenyl)-9-hydroxy-3H-benzo[e]benzimidazole-7-sulfonic acid |
|---|---|
| PubChem CID | 10303511 |
| Molecular Formula | C30H20N2O6S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 2-(4-dibenzofuran-4-yl-2-methoxyphenyl)-9-hydroxy-3H-benzo[e]benzimidazole-7-sulfonic acid |
| SMILES | COc1cc(-c2cccc3c2oc2ccccc23)ccc1-c1nc2c(ccc3cc(S(=O)(=O)O)cc(O)c32)[nH]1 |
| InChI | InChI=1S/C30H20N2O6S/c1-37-26-14-16(19-6-4-7-21-20-5-2-3-8-25(20)38-29(19)21)9-11-22(26)30-31-23-12-10-17-13-18(39(34,35)36)15-24(33)27(17)28(23)32-30/h2-15,33H,1H3,(H,31,32)(H,34,35,36) |
| InChIKey | QOBXVDSMCOBMPQ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|