C24H17ClN2O5S — CID 10279503
2-[4-(4-chlorophenyl)-2-methoxyphenyl]-9-hydroxy-3H-benzo[e]benzimidazole-5-sulfonic acid (PubChem CID 10279503) has the molecular formula C24H17ClN2O5S and a molecular weight of 480.93 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-2-methoxyphenyl]-9-hydroxy-3H-benzo[e]benzimidazole-5-sulfonic acid.
| Compound Name | 2-[4-(4-chlorophenyl)-2-methoxyphenyl]-9-hydroxy-3H-benzo[e]benzimidazole-5-sulfonic acid |
|---|---|
| PubChem CID | 10279503 |
| Molecular Formula | C24H17ClN2O5S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-2-methoxyphenyl]-9-hydroxy-3H-benzo[e]benzimidazole-5-sulfonic acid |
| SMILES | COc1cc(-c2ccc(Cl)cc2)ccc1-c1nc2c(cc(S(=O)(=O)O)c3cccc(O)c32)[nH]1 |
| InChI | InChI=1S/C24H17ClN2O5S/c1-32-20-11-14(13-5-8-15(25)9-6-13)7-10-16(20)24-26-18-12-21(33(29,30)31)17-3-2-4-19(28)22(17)23(18)27-24/h2-12,28H,1H3,(H,26,27)(H,29,30,31) |
| InChIKey | WLQLOGIPDQRBMB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|