C10H10ClFO2S — CID 103037737
2-[(3-chloro-4-fluorophenyl)methylsulfanyl]propanoic acid (PubChem CID 103037737) has the molecular formula C10H10ClFO2S and a molecular weight of 248.71 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methylsulfanyl]propanoic acid.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 103037737 |
| Molecular Formula | C10H10ClFO2S |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methylsulfanyl]propanoic acid |
| SMILES | CC(SCc1ccc(F)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C10H10ClFO2S/c1-6(10(13)14)15-5-7-2-3-9(12)8(11)4-7/h2-4,6H,5H2,1H3,(H,13,14) |
| InChIKey | DPJDQRBYLAFQNZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |