C15H19ClFN — CID 103041671
3-[(3-chloro-4-fluorophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-amine (PubChem CID 103041671) has the molecular formula C15H19ClFN and a molecular weight of 267.78 g/mol. Its IUPAC name is 3-[(3-chloro-4-fluorophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-amine.
| Compound Name | 3-[(3-chloro-4-fluorophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 103041671 |
| Molecular Formula | C15H19ClFN |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 3-[(3-chloro-4-fluorophenyl)methyl]-5,5-dimethylcyclohex-2-en-1-amine |
| SMILES | CC1(C)CC(Cc2ccc(F)c(Cl)c2)=CC(N)C1 |
| InChI | InChI=1S/C15H19ClFN/c1-15(2)8-11(6-12(18)9-15)5-10-3-4-14(17)13(16)7-10/h3-4,6-7,12H,5,8-9,18H2,1-2H3 |
| InChIKey | DHTQBOYPTMPVHR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|