C15H17Cl2F — CID 65174260
2-chloro-1-[(3-chloro-5,5-dimethylcyclohexen-1-yl)methyl]-4-fluorobenzene (PubChem CID 65174260) has the molecular formula C15H17Cl2F and a molecular weight of 287.20 g/mol. Its IUPAC name is 2-chloro-1-[(3-chloro-5,5-dimethylcyclohexen-1-yl)methyl]-4-fluorobenzene.
| Compound Name | 2-chloro-1-[(3-chloro-5,5-dimethylcyclohexen-1-yl)methyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 65174260 |
| Molecular Formula | C15H17Cl2F |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-chloro-1-[(3-chloro-5,5-dimethylcyclohexen-1-yl)methyl]-4-fluorobenzene |
| SMILES | CC1(C)CC(Cc2ccc(F)cc2Cl)=CC(Cl)C1 |
| InChI | InChI=1S/C15H17Cl2F/c1-15(2)8-10(6-12(16)9-15)5-11-3-4-13(18)7-14(11)17/h3-4,6-7,12H,5,8-9H2,1-2H3 |
| InChIKey | QLXDDWJPMHTYSD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|