C15H17BrClF — CID 65174562
4-bromo-2-[(3-chloro-5,5-dimethylcyclohexen-1-yl)methyl]-1-fluorobenzene (PubChem CID 65174562) has the molecular formula C15H17BrClF and a molecular weight of 331.66 g/mol. Its IUPAC name is 4-bromo-2-[(3-chloro-5,5-dimethylcyclohexen-1-yl)methyl]-1-fluorobenzene.
| Compound Name | 4-bromo-2-[(3-chloro-5,5-dimethylcyclohexen-1-yl)methyl]-1-fluorobenzene |
|---|---|
| PubChem CID | 65174562 |
| Molecular Formula | C15H17BrClF |
| Molecular Weight | 331.66 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 4-bromo-2-[(3-chloro-5,5-dimethylcyclohexen-1-yl)methyl]-1-fluorobenzene |
| SMILES | CC1(C)CC(Cc2cc(Br)ccc2F)=CC(Cl)C1 |
| InChI | InChI=1S/C15H17BrClF/c1-15(2)8-10(6-13(17)9-15)5-11-7-12(16)3-4-14(11)18/h3-4,6-7,13H,5,8-9H2,1-2H3 |
| InChIKey | FUSFCRAOJCOSEN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|