C12H12BrF — CID 130943744
4-bromo-2-(cyclopenten-1-ylmethyl)-1-fluorobenzene (PubChem CID 130943744) has the molecular formula C12H12BrF and a molecular weight of 255.13 g/mol. Its IUPAC name is 4-bromo-2-(cyclopenten-1-ylmethyl)-1-fluorobenzene.
| Compound Name | 4-bromo-2-(cyclopenten-1-ylmethyl)-1-fluorobenzene |
|---|---|
| PubChem CID | 130943744 |
| Molecular Formula | C12H12BrF |
| Molecular Weight | 255.13 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 4-bromo-2-(cyclopenten-1-ylmethyl)-1-fluorobenzene |
| SMILES | Fc1ccc(Br)cc1CC1=CCCC1 |
| InChI | InChI=1S/C12H12BrF/c13-11-5-6-12(14)10(8-11)7-9-3-1-2-4-9/h3,5-6,8H,1-2,4,7H2 |
| InChIKey | MSSBXFZGEBAIHZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.13 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|