C33H30Br3F3 — CID 139256775
1,3,5-tris[(5-bromo-2-fluorophenyl)methyl]-2,4,6-triethylbenzene (PubChem CID 139256775) has the molecular formula C33H30Br3F3 and a molecular weight of 723.31 g/mol. Its IUPAC name is 1,3,5-tris[(5-bromo-2-fluorophenyl)methyl]-2,4,6-triethylbenzene.
| Compound Name | 1,3,5-tris[(5-bromo-2-fluorophenyl)methyl]-2,4,6-triethylbenzene |
|---|---|
| PubChem CID | 139256775 |
| Molecular Formula | C33H30Br3F3 |
| Molecular Weight | 723.31 g/mol |
| Exact Mass | 719.98 |
| IUPAC Name | 1,3,5-tris[(5-bromo-2-fluorophenyl)methyl]-2,4,6-triethylbenzene |
| SMILES | CCc1c(Cc2cc(Br)ccc2F)c(CC)c(Cc2cc(Br)ccc2F)c(CC)c1Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C33H30Br3F3/c1-4-25-28(16-19-13-22(34)7-10-31(19)37)26(5-2)30(18-21-15-24(36)9-12-33(21)39)27(6-3)29(25)17-20-14-23(35)8-11-32(20)38/h7-15H,4-6,16-18H2,1-3H3 |
| InChIKey | BFQNWBWIGALWCQ-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.31 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |