C14H15BrF3N — CID 106177582
4-bromo-N-[2-(cyclopenten-1-yl)ethyl]-2-(trifluoromethyl)aniline (PubChem CID 106177582) has the molecular formula C14H15BrF3N and a molecular weight of 334.18 g/mol. Its IUPAC name is 4-bromo-N-[2-(cyclopenten-1-yl)ethyl]-2-(trifluoromethyl)aniline.
| Compound Name | 4-bromo-N-[2-(cyclopenten-1-yl)ethyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 106177582 |
| Molecular Formula | C14H15BrF3N |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 4-bromo-N-[2-(cyclopenten-1-yl)ethyl]-2-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(Br)ccc1NCCC1=CCCC1 |
| InChI | InChI=1S/C14H15BrF3N/c15-11-5-6-13(12(9-11)14(16,17)18)19-8-7-10-3-1-2-4-10/h3,5-6,9,19H,1-2,4,7-8H2 |
| InChIKey | ANMRXDMKTIAUCN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|