C14H15BrN2 — CID 106173601
5-bromo-2-[2-(cyclopenten-1-yl)ethylamino]benzonitrile (PubChem CID 106173601) has the molecular formula C14H15BrN2 and a molecular weight of 291.19 g/mol. Its IUPAC name is 5-bromo-2-[2-(cyclopenten-1-yl)ethylamino]benzonitrile.
| Compound Name | 5-bromo-2-[2-(cyclopenten-1-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 106173601 |
| Molecular Formula | C14H15BrN2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 5-bromo-2-[2-(cyclopenten-1-yl)ethylamino]benzonitrile |
| SMILES | N#Cc1cc(Br)ccc1NCCC1=CCCC1 |
| InChI | InChI=1S/C14H15BrN2/c15-13-5-6-14(12(9-13)10-16)17-8-7-11-3-1-2-4-11/h3,5-6,9,17H,1-2,4,7-8H2 |
| InChIKey | FELMMKHFEGWPJH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|