C35H63NO5Si — CID 10304268
[8-[7-(tert-butylamino)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 10304268) has the molecular formula C35H63NO5Si and a molecular weight of 605.98 g/mol. Its IUPAC name is [8-[7-(tert-butylamino)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [8-[7-(tert-butylamino)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 10304268 |
| Molecular Formula | C35H63NO5Si |
| Molecular Weight | 605.98 g/mol |
| Exact Mass | 605.45 |
| IUPAC Name | [8-[7-(tert-butylamino)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC(O)CC(CC(=O)NC(C)(C)C)O[Si](C)(C)C(C)(C)C)C21 |
| InChI | InChI=1S/C35H63NO5Si/c1-14-35(10,11)32(39)40-29-20-23(2)19-25-16-15-24(3)28(31(25)29)18-17-26(37)21-27(22-30(38)36-33(4,5)6)41-42(12,13)34(7,8)9/h15-16,19,23-24,26-29,31,37H,14,17-18,20-22H2,1-13H3,(H,36,38) |
| InChIKey | OXKDPVWLFFWDEZ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.98 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|