C35H61NO5Si — CID 11753731
[(1S,3R,7S,8S,8aR)-8-[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxo-7-pyrrolidin-1-ylheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 11753731) has the molecular formula C35H61NO5Si and a molecular weight of 603.96 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-8-[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxo-7-pyrrolidin-1-ylheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-8-[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxo-7-pyrrolidin-1-ylheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 11753731 |
| Molecular Formula | C35H61NO5Si |
| Molecular Weight | 603.96 g/mol |
| Exact Mass | 603.43 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-8-[(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxo-7-pyrrolidin-1-ylheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H](O)C[C@H](CC(=O)N3CCCC3)O[Si](C)(C)C(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C35H61NO5Si/c1-11-35(7,8)33(39)40-30-21-24(2)20-26-15-14-25(3)29(32(26)30)17-16-27(37)22-28(41-42(9,10)34(4,5)6)23-31(38)36-18-12-13-19-36/h14-15,20,24-25,27-30,32,37H,11-13,16-19,21-23H2,1-10H3/t24-,25-,27+,28+,29-,30-,32-/m0/s1 |
| InChIKey | PPPOHHFGRJFOMO-ZCUTYBCMSA-N |
| XLogP | 7.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.96 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|