C30H47NO6 — CID 10164831
[8-[5-acetyloxy-7-(cyclopropylamino)-3-hydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 10164831) has the molecular formula C30H47NO6 and a molecular weight of 517.71 g/mol. Its IUPAC name is [8-[5-acetyloxy-7-(cyclopropylamino)-3-hydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [8-[5-acetyloxy-7-(cyclopropylamino)-3-hydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 10164831 |
| Molecular Formula | C30H47NO6 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | [8-[5-acetyloxy-7-(cyclopropylamino)-3-hydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC(O)CC(CC(=O)NC3CC3)OC(C)=O)C21 |
| InChI | InChI=1S/C30H47NO6/c1-7-30(5,6)29(35)37-26-15-18(2)14-21-9-8-19(3)25(28(21)26)13-12-23(33)16-24(36-20(4)32)17-27(34)31-22-10-11-22/h8-9,14,18-19,22-26,28,33H,7,10-13,15-17H2,1-6H3,(H,31,34) |
| InChIKey | AOMJIVYFQZFGJL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |