C15H12ClFN2O — CID 103047668
2-(5-chloro-2-fluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol (PubChem CID 103047668) has the molecular formula C15H12ClFN2O and a molecular weight of 290.73 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol |
|---|---|
| PubChem CID | 103047668 |
| Molecular Formula | C15H12ClFN2O |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol |
| SMILES | OC(Cc1cc(Cl)ccc1F)c1cn2ccccc2n1 |
| InChI | InChI=1S/C15H12ClFN2O/c16-11-4-5-12(17)10(7-11)8-14(20)13-9-19-6-2-1-3-15(19)18-13/h1-7,9,14,20H,8H2 |
| InChIKey | GQJOWECMDYYLRG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |