About 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol
2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol (PubChem CID 82920663) has the molecular formula C15H12F2N2O
and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol |
| PubChem CID | 82920663 |
| Molecular Formula | C15H12F2N2O |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol |
| SMILES | OC(Cc1ccc(F)c(F)c1)c1cn2ccccc2n1 |
| InChI | InChI=1S/C15H12F2N2O/c16-11-5-4-10(7-12(11)17)8-14(20)13-9-19-6-2-1-3-15(19)18-13/h1-7,9,14,20H,8H2 |
| InChIKey | XICFWHCFUWZGOI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol?
The IUPAC name of 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol (CID 82920663) is 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol.
What is the SMILES notation for 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol?
The canonical SMILES for 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol is OC(Cc1ccc(F)c(F)c1)c1cn2ccccc2n1.
What is the InChIKey of 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol?
The InChIKey is XICFWHCFUWZGOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F2N2O/c16-11-5-4-10(7-12(11)17)8-14(20)13-9-19-6-2-1-3-15(19)18-13/h1-7,9,14,20H,8H2.
What are the key properties of 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol?
2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol has a molecular weight of 274.27 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-1-imidazo[1,2-a]pyridin-2-ylethanol is sourced from PubChem (CID 82920663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).